About 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane
2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane (PubChem CID 145049296) has the molecular formula C16H23F2N5S
and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane.
Molecular Properties
| Compound Name | 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane |
| PubChem CID | 145049296 |
| Molecular Formula | C16H23F2N5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane |
| SMILES | CC.CC.Nc1csc(-c2cnc(N3CC4C(C3)C4(F)F)nc2)n1 |
| InChI | InChI=1S/C12H11F2N5S.2C2H6/c13-12(14)7-3-19(4-8(7)12)11-16-1-6(2-17-11)10-18-9(15)5-20-10;2*1-2/h1-2,5,7-8H,3-4,15H2;2*1-2H3 |
| InChIKey | MJGKYMSRXRXFDF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane?
The IUPAC name of 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane (CID 145049296) is 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane.
What is the SMILES notation for 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane?
The canonical SMILES for 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane is CC.CC.Nc1csc(-c2cnc(N3CC4C(C3)C4(F)F)nc2)n1.
What is the InChIKey of 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane?
The InChIKey is MJGKYMSRXRXFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2N5S.2C2H6/c13-12(14)7-3-19(4-8(7)12)11-16-1-6(2-17-11)10-18-9(15)5-20-10;2*1-2/h1-2,5,7-8H,3-4,15H2;2*1-2H3.
What are the key properties of 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane?
2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane has a molecular weight of 355.46 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-amine;ethane is sourced from PubChem (CID 145049296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).