C6H13FN2 — CID 145049655
1-fluoro-2,4-dimethylpiperazine (PubChem CID 145049655) has the molecular formula C6H13FN2 and a molecular weight of 132.18 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethylpiperazine.
| Compound Name | 1-fluoro-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 145049655 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 1-fluoro-2,4-dimethylpiperazine |
| SMILES | CC1CN(C)CCN1F |
| InChI | InChI=1S/C6H13FN2/c1-6-5-8(2)3-4-9(6)7/h6H,3-5H2,1-2H3 |
| InChIKey | XXCZEAXBEYVAML-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|