C15H15N3 — CID 145049717
7-ethyl-3-methyl-6-phenylimidazo[1,2-b]pyridazine (PubChem CID 145049717) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 7-ethyl-3-methyl-6-phenylimidazo[1,2-b]pyridazine.
| Compound Name | 7-ethyl-3-methyl-6-phenylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 145049717 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 7-ethyl-3-methyl-6-phenylimidazo[1,2-b]pyridazine |
| SMILES | CCc1cc2ncc(C)n2nc1-c1ccccc1 |
| InChI | InChI=1S/C15H15N3/c1-3-12-9-14-16-10-11(2)18(14)17-15(12)13-7-5-4-6-8-13/h4-10H,3H2,1-2H3 |
| InChIKey | FRSFTUZCHJTDKP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |