C32H21NO3 — CID 145050011
3,4-bis(ethenyl)-1-(6-oxobenzo[c]chromen-9-yl)-6-phenylquinolin-2-one (PubChem CID 145050011) has the molecular formula C32H21NO3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1-(6-oxobenzo[c]chromen-9-yl)-6-phenylquinolin-2-one.
| Compound Name | 3,4-bis(ethenyl)-1-(6-oxobenzo[c]chromen-9-yl)-6-phenylquinolin-2-one |
|---|---|
| PubChem CID | 145050011 |
| Molecular Formula | C32H21NO3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3,4-bis(ethenyl)-1-(6-oxobenzo[c]chromen-9-yl)-6-phenylquinolin-2-one |
| SMILES | C=Cc1c(C=C)c2cc(-c3ccccc3)ccc2n(-c2ccc3c(=O)oc4ccccc4c3c2)c1=O |
| InChI | InChI=1S/C32H21NO3/c1-3-23-24(4-2)31(34)33(29-17-14-21(18-28(23)29)20-10-6-5-7-11-20)22-15-16-26-27(19-22)25-12-8-9-13-30(25)36-32(26)35/h3-19H,1-2H2 |
| InChIKey | FWIHVXJVRXGTLW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|