C63H62O13S — CID 14505031
[4,5-dibenzoyloxy-6-ethylsulfanyl-2-[[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate (PubChem CID 14505031) has the molecular formula C63H62O13S and a molecular weight of 1059.24 g/mol. Its IUPAC name is [4,5-dibenzoyloxy-6-ethylsulfanyl-2-[[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate.
| Compound Name | [4,5-dibenzoyloxy-6-ethylsulfanyl-2-[[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 14505031 |
| Molecular Formula | C63H62O13S |
| Molecular Weight | 1059.24 g/mol |
| Exact Mass | 1058.39 |
| IUPAC Name | [4,5-dibenzoyloxy-6-ethylsulfanyl-2-[[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate |
| SMILES | CCSC1OC(COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C63H62O13S/c1-2-77-63-58(76-61(66)50-36-22-9-23-37-50)56(75-60(65)49-34-20-8-21-35-49)54(74-59(64)48-32-18-7-19-33-48)52(73-63)43-71-62-57(70-41-47-30-16-6-17-31-47)55(69-40-46-28-14-5-15-29-46)53(68-39-45-26-12-4-13-27-45)51(72-62)42-67-38-44-24-10-3-11-25-44/h3-37,51-58,62-63H,2,38-43H2,1H3 |
| InChIKey | ZDOJMCMLKNFAKH-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.24 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|