C18H30N6O4S — CID 145050692
ethane;2-methoxyethyl 2-[methyl(nitroso)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate;pyrrolidine-1-carbonitrile (PubChem CID 145050692) has the molecular formula C18H30N6O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is ethane;2-methoxyethyl 2-[methyl(nitroso)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate;pyrrolidine-1-carbonitrile.
| Compound Name | ethane;2-methoxyethyl 2-[methyl(nitroso)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate;pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 145050692 |
| Molecular Formula | C18H30N6O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | ethane;2-methoxyethyl 2-[methyl(nitroso)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate;pyrrolidine-1-carbonitrile |
| SMILES | CC.COCCOC(=O)N1CCc2nc(N(C)N=O)sc2C1.N#CN1CCCC1 |
| InChI | InChI=1S/C11H16N4O4S.C5H8N2.C2H6/c1-14(13-17)10-12-8-3-4-15(7-9(8)20-10)11(16)19-6-5-18-2;6-5-7-3-1-2-4-7;1-2/h3-7H2,1-2H3;1-4H2;1-2H3 |
| InChIKey | RKSCJCVZLBADTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|