C31H20F4N2O2 — CID 145051582
[2-[2-[1-(3,5-difluoro-2-pyridin-2-ylphenyl)ethyl]-4,6-difluorophenyl]phenyl] pyridine-2-carboxylate (PubChem CID 145051582) has the molecular formula C31H20F4N2O2 and a molecular weight of 528.51 g/mol. Its IUPAC name is [2-[2-[1-(3,5-difluoro-2-pyridin-2-ylphenyl)ethyl]-4,6-difluorophenyl]phenyl] pyridine-2-carboxylate.
| Compound Name | [2-[2-[1-(3,5-difluoro-2-pyridin-2-ylphenyl)ethyl]-4,6-difluorophenyl]phenyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 145051582 |
| Molecular Formula | C31H20F4N2O2 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | [2-[2-[1-(3,5-difluoro-2-pyridin-2-ylphenyl)ethyl]-4,6-difluorophenyl]phenyl] pyridine-2-carboxylate |
| SMILES | CC(c1cc(F)cc(F)c1-c1ccccn1)c1cc(F)cc(F)c1-c1ccccc1OC(=O)c1ccccn1 |
| InChI | InChI=1S/C31H20F4N2O2/c1-18(23-15-20(33)17-25(35)30(23)26-9-4-6-12-36-26)22-14-19(32)16-24(34)29(22)21-8-2-3-11-28(21)39-31(38)27-10-5-7-13-37-27/h2-18H,1H3 |
| InChIKey | ZRDYZBGPUZDMBO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|