C25H46N11O2P — CID 145051817
2-[4-[6-amino-2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]pyrimidin-4-yl]piperazin-1-yl]ethylphosphonous acid (PubChem CID 145051817) has the molecular formula C25H46N11O2P and a molecular weight of 563.69 g/mol. Its IUPAC name is 2-[4-[6-amino-2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]pyrimidin-4-yl]piperazin-1-yl]ethylphosphonous acid.
| Compound Name | 2-[4-[6-amino-2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]pyrimidin-4-yl]piperazin-1-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 145051817 |
| Molecular Formula | C25H46N11O2P |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 2-[4-[6-amino-2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]pyrimidin-4-yl]piperazin-1-yl]ethylphosphonous acid |
| SMILES | Nc1cc(N2CCN(CCP(O)O)CC2)nc(NCc2cn(CCCNCCCNC3CCCCC3)nn2)n1 |
| InChI | InChI=1S/C25H46N11O2P/c26-23-18-24(35-14-12-34(13-15-35)16-17-39(37)38)31-25(30-23)29-19-22-20-36(33-32-22)11-5-9-27-8-4-10-28-21-6-2-1-3-7-21/h18,20-21,27-28,37-38H,1-17,19H2,(H3,26,29,30,31) |
| InChIKey | VZIRXZSXQYTAFL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 165.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|