C26H46O3Si — CID 145052081
trihexoxy(2-phenylethenyl)silane (PubChem CID 145052081) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is trihexoxy(2-phenylethenyl)silane.
| Compound Name | trihexoxy(2-phenylethenyl)silane |
|---|---|
| PubChem CID | 145052081 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | trihexoxy(2-phenylethenyl)silane |
| SMILES | CCCCCCO[Si](C=Cc1ccccc1)(OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C26H46O3Si/c1-4-7-10-16-22-27-30(28-23-17-11-8-5-2,29-24-18-12-9-6-3)25-21-26-19-14-13-15-20-26/h13-15,19-21,25H,4-12,16-18,22-24H2,1-3H3 |
| InChIKey | GEMVUXDFFKQBMY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|