C21H22FN3O3 — CID 145052196
4-[[(3aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 145052196) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 4-[[(3aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]cyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 4-[[(3aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]cyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 145052196 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[[(3aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | N#CC1=CCC(OC2CC3CN(CC(=O)c4ccc(O)c(F)n4)C[C@H]3C2)C=C1 |
| InChI | InChI=1S/C21H22FN3O3/c22-21-19(26)6-5-18(24-21)20(27)12-25-10-14-7-17(8-15(14)11-25)28-16-3-1-13(9-23)2-4-16/h1-3,5-6,14-17,26H,4,7-8,10-12H2/t14-,15?,16?,17?/m1/s1 |
| InChIKey | CXTHKJAGYXUHPC-UKBSLWIUSA-N |
| XLogP | 2.61 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|