C22H27FN2O4 — CID 145052206
6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-methoxyethyl]-2-fluoropyridin-3-ol (PubChem CID 145052206) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-methoxyethyl]-2-fluoropyridin-3-ol.
| Compound Name | 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-methoxyethyl]-2-fluoropyridin-3-ol |
|---|---|
| PubChem CID | 145052206 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-methoxyethyl]-2-fluoropyridin-3-ol |
| SMILES | COc1ccc(OC2C[C@@H]3CN(CC(OC)c4ccc(O)c(F)n4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H27FN2O4/c1-27-16-3-5-17(6-4-16)29-18-9-14-11-25(12-15(14)10-18)13-21(28-2)19-7-8-20(26)22(23)24-19/h3-8,14-15,18,21,26H,9-13H2,1-2H3/t14-,15+,18?,21? |
| InChIKey | JPCUBYOPEDRYFE-CHLRHJHGSA-N |
| XLogP | 3.41 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|