About cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone
cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone (PubChem CID 145053869) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone |
| PubChem CID | 145053869 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone |
| SMILES | Cc1cc(C(=O)C2=CC=CCC2)c(C)cc1OC(C)C |
| InChI | InChI=1S/C18H22O2/c1-12(2)20-17-11-13(3)16(10-14(17)4)18(19)15-8-6-5-7-9-15/h5-6,8,10-12H,7,9H2,1-4H3 |
| InChIKey | OYFZXSOGORLLCC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone?
The IUPAC name of cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone (CID 145053869) is cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone.
What is the SMILES notation for cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone?
The canonical SMILES for cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone is Cc1cc(C(=O)C2=CC=CCC2)c(C)cc1OC(C)C.
What is the InChIKey of cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone?
The InChIKey is OYFZXSOGORLLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c1-12(2)20-17-11-13(3)16(10-14(17)4)18(19)15-8-6-5-7-9-15/h5-6,8,10-12H,7,9H2,1-4H3.
What are the key properties of cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone?
cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone has a molecular weight of 270.37 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-1-yl-(2,5-dimethyl-4-propan-2-yloxyphenyl)methanone is sourced from PubChem (CID 145053869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).