C16H25F2NO — CID 145054416
(3E)-3-[(2Z)-4-(difluoromethoxy)penta-2,4-dienylidene]-7-ethyl-2,5-dimethylazepane (PubChem CID 145054416) has the molecular formula C16H25F2NO and a molecular weight of 285.38 g/mol. Its IUPAC name is (3E)-3-[(2Z)-4-(difluoromethoxy)penta-2,4-dienylidene]-7-ethyl-2,5-dimethylazepane.
| Compound Name | (3E)-3-[(2Z)-4-(difluoromethoxy)penta-2,4-dienylidene]-7-ethyl-2,5-dimethylazepane |
|---|---|
| PubChem CID | 145054416 |
| Molecular Formula | C16H25F2NO |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (3E)-3-[(2Z)-4-(difluoromethoxy)penta-2,4-dienylidene]-7-ethyl-2,5-dimethylazepane |
| SMILES | C=C(/C=C\C=C1/CC(C)CC(CC)NC1C)OC(F)F |
| InChI | InChI=1S/C16H25F2NO/c1-5-15-10-11(2)9-14(13(4)19-15)8-6-7-12(3)20-16(17)18/h6-8,11,13,15-16,19H,3,5,9-10H2,1-2,4H3/b7-6-,14-8+ |
| InChIKey | PWHOFIJLOBSTHD-BHWOWGIZSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|