About 6-chloro-1,4-dimethyl-2H-pyridine;ethane
6-chloro-1,4-dimethyl-2H-pyridine;ethane (PubChem CID 145054930) has the molecular formula C9H16ClN
and a molecular weight of 173.69 g/mol. Its IUPAC name is 6-chloro-1,4-dimethyl-2H-pyridine;ethane.
Molecular Properties
| Compound Name | 6-chloro-1,4-dimethyl-2H-pyridine;ethane |
| PubChem CID | 145054930 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 6-chloro-1,4-dimethyl-2H-pyridine;ethane |
| SMILES | CC.CC1=CCN(C)C(Cl)=C1 |
| InChI | InChI=1S/C7H10ClN.C2H6/c1-6-3-4-9(2)7(8)5-6;1-2/h3,5H,4H2,1-2H3;1-2H3 |
| InChIKey | REQKLQFJUSTROP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,4-dimethyl-2H-pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,4-dimethyl-2H-pyridine;ethane?
The IUPAC name of 6-chloro-1,4-dimethyl-2H-pyridine;ethane (CID 145054930) is 6-chloro-1,4-dimethyl-2H-pyridine;ethane.
What is the SMILES notation for 6-chloro-1,4-dimethyl-2H-pyridine;ethane?
The canonical SMILES for 6-chloro-1,4-dimethyl-2H-pyridine;ethane is CC.CC1=CCN(C)C(Cl)=C1.
What is the InChIKey of 6-chloro-1,4-dimethyl-2H-pyridine;ethane?
The InChIKey is REQKLQFJUSTROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN.C2H6/c1-6-3-4-9(2)7(8)5-6;1-2/h3,5H,4H2,1-2H3;1-2H3.
What are the key properties of 6-chloro-1,4-dimethyl-2H-pyridine;ethane?
6-chloro-1,4-dimethyl-2H-pyridine;ethane has a molecular weight of 173.69 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,4-dimethyl-2H-pyridine;ethane is sourced from PubChem (CID 145054930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).