C31H27N3O5S — CID 145055073
2-(4-carboxy-2-pyridinyl)-6-[4-[5-(3-hexylthiophen-2-yl)furan-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid (PubChem CID 145055073) has the molecular formula C31H27N3O5S and a molecular weight of 553.64 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(3-hexylthiophen-2-yl)furan-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(3-hexylthiophen-2-yl)furan-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145055073 |
| Molecular Formula | C31H27N3O5S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(3-hexylthiophen-2-yl)furan-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
| SMILES | CCCCCCc1ccsc1-c1ccc(-c2ccnc(-c3cc(C(=O)O)cc(-c4cc(C(=O)O)ccn4)n3)c2)o1 |
| InChI | InChI=1S/C31H27N3O5S/c1-2-3-4-5-6-19-11-14-40-29(19)28-8-7-27(39-28)20-9-12-32-23(15-20)25-17-22(31(37)38)18-26(34-25)24-16-21(30(35)36)10-13-33-24/h7-18H,2-6H2,1H3,(H,35,36)(H,37,38) |
| InChIKey | MPKRCPUZFLHLAL-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|