C35H29N3O5S2 — CID 145055127
2-(4-carboxy-2-pyridinyl)-6-[4-[5-[5-(3-hexylthiophen-2-yl)furan-2-yl]thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid (PubChem CID 145055127) has the molecular formula C35H29N3O5S2 and a molecular weight of 635.77 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-6-[4-[5-[5-(3-hexylthiophen-2-yl)furan-2-yl]thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-[5-(3-hexylthiophen-2-yl)furan-2-yl]thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145055127 |
| Molecular Formula | C35H29N3O5S2 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-[5-(3-hexylthiophen-2-yl)furan-2-yl]thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
| SMILES | CCCCCCc1ccsc1-c1ccc(-c2ccc(-c3ccnc(-c4cc(C(=O)O)cc(-c5cc(C(=O)O)ccn5)n4)c3)s2)o1 |
| InChI | InChI=1S/C35H29N3O5S2/c1-2-3-4-5-6-21-13-16-44-33(21)30-8-7-29(43-30)32-10-9-31(45-32)22-11-14-36-25(17-22)27-19-24(35(41)42)20-28(38-27)26-18-23(34(39)40)12-15-37-26/h7-20H,2-6H2,1H3,(H,39,40)(H,41,42) |
| InChIKey | SBNWOSFQWNFZTC-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|