C18H26 — CID 145055342
ethane;2-[1-[(3E)-hexa-1,3,5-trien-3-yl]cyclopentyl]cyclopenta-1,3-diene (PubChem CID 145055342) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;2-[1-[(3E)-hexa-1,3,5-trien-3-yl]cyclopentyl]cyclopenta-1,3-diene.
| Compound Name | ethane;2-[1-[(3E)-hexa-1,3,5-trien-3-yl]cyclopentyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 145055342 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;2-[1-[(3E)-hexa-1,3,5-trien-3-yl]cyclopentyl]cyclopenta-1,3-diene |
| SMILES | C=C/C=C(\C=C)C1(C2=CCC=C2)CCCC1.CC |
| InChI | InChI=1S/C16H20.C2H6/c1-3-9-14(4-2)16(12-7-8-13-16)15-10-5-6-11-15;1-2/h3-5,9-11H,1-2,6-8,12-13H2;1-2H3/b14-9+; |
| InChIKey | CIYLMNZSQOOQSB-KYIGKLDSSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|