C15H13F7N3O4S+ — CID 145055477
6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3-tetrafluoropropoxy)-1H-pyridazin-2-ium 2-oxide (PubChem CID 145055477) has the molecular formula C15H13F7N3O4S+ and a molecular weight of 464.34 g/mol. Its IUPAC name is 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3-tetrafluoropropoxy)-1H-pyridazin-2-ium 2-oxide.
| Compound Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3-tetrafluoropropoxy)-1H-pyridazin-2-ium 2-oxide |
|---|---|
| PubChem CID | 145055477 |
| Molecular Formula | C15H13F7N3O4S+ |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3-tetrafluoropropoxy)-1H-pyridazin-2-ium 2-oxide |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1ccc(OCC(F)(F)C(F)F)[n+](=O)[nH]1 |
| InChI | InChI=1S/C15H13F7N3O4S/c1-2-30(27,28)10-5-8(15(20,21)22)6-23-12(10)9-3-4-11(25(26)24-9)29-7-14(18,19)13(16)17/h3-6,13H,2,7H2,1H3,(H,24,26)/q+1 |
| InChIKey | QZKDUIPAIVNSKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|