C15H12F8N3O4S+ — CID 145055480
6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridazin-2-ium 2-oxide (PubChem CID 145055480) has the molecular formula C15H12F8N3O4S+ and a molecular weight of 482.33 g/mol. Its IUPAC name is 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridazin-2-ium 2-oxide.
| Compound Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridazin-2-ium 2-oxide |
|---|---|
| PubChem CID | 145055480 |
| Molecular Formula | C15H12F8N3O4S+ |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridazin-2-ium 2-oxide |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1ccc(OCC(F)(F)C(F)(F)F)[n+](=O)[nH]1 |
| InChI | InChI=1S/C15H12F8N3O4S/c1-2-31(28,29)10-5-8(14(18,19)20)6-24-12(10)9-3-4-11(26(27)25-9)30-7-13(16,17)15(21,22)23/h3-6H,2,7H2,1H3,(H,25,27)/q+1 |
| InChIKey | QKTQXCSVWJABGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|