About 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide
3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide (PubChem CID 145055481) has the molecular formula C12H13ClN3O3S+
and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide.
Molecular Properties
| Compound Name | 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide |
| PubChem CID | 145055481 |
| Molecular Formula | C12H13ClN3O3S+ |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide |
| SMILES | CCS(=O)(=O)c1cccnc1-c1[nH][n+](=O)c(Cl)cc1C |
| InChI | InChI=1S/C12H13ClN3O3S/c1-3-20(18,19)9-5-4-6-14-12(9)11-8(2)7-10(13)16(17)15-11/h4-7H,3H2,1-2H3,(H,15,17)/q+1 |
| InChIKey | NXFPYOZJWWIDHS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide?
The IUPAC name of 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide (CID 145055481) is 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide.
What is the SMILES notation for 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide?
The canonical SMILES for 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide is CCS(=O)(=O)c1cccnc1-c1[nH][n+](=O)c(Cl)cc1C.
What is the InChIKey of 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide?
The InChIKey is NXFPYOZJWWIDHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN3O3S/c1-3-20(18,19)9-5-4-6-14-12(9)11-8(2)7-10(13)16(17)15-11/h4-7H,3H2,1-2H3,(H,15,17)/q+1.
What are the key properties of 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide?
3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide has a molecular weight of 314.77 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide is sourced from PubChem (CID 145055481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).