C21H23N3O2 — CID 145055539
4-[[3-[(cyclohexa-1,5-dien-1-ylamino)methylamino]anilino]methyl]benzoic acid (PubChem CID 145055539) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[[3-[(cyclohexa-1,5-dien-1-ylamino)methylamino]anilino]methyl]benzoic acid.
| Compound Name | 4-[[3-[(cyclohexa-1,5-dien-1-ylamino)methylamino]anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 145055539 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-[[3-[(cyclohexa-1,5-dien-1-ylamino)methylamino]anilino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2cccc(NCNC3=CCCC=C3)c2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c25-21(26)17-11-9-16(10-12-17)14-22-19-7-4-8-20(13-19)24-15-23-18-5-2-1-3-6-18/h2,4-13,22-24H,1,3,14-15H2,(H,25,26) |
| InChIKey | BBGWVYWTSXUEKE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|