C16H20O3 — CID 145055882
1,2-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethoxyethanone (PubChem CID 145055882) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 1,2-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethoxyethanone.
| Compound Name | 1,2-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 145055882 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1,2-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)(C(=O)C1=CCCC=C1)C1=CCCC=C1 |
| InChI | InChI=1S/C16H20O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h5,7,9-12H,3-4,6,8H2,1-2H3 |
| InChIKey | YNHCSGSGHMOURP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|