About butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine
butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine (PubChem CID 145056501) has the molecular formula C25H34F3NO
and a molecular weight of 421.55 g/mol. Its IUPAC name is butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine.
Molecular Properties
| Compound Name | butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine |
| PubChem CID | 145056501 |
| Molecular Formula | C25H34F3NO |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine |
| SMILES | C=C(N)c1ccc(CCc2ccc(CCCC)cc2)c(C(F)(F)F)c1.CCCCO |
| InChI | InChI=1S/C21H24F3N.C4H10O/c1-3-4-5-16-6-8-17(9-7-16)10-11-18-12-13-19(15(2)25)14-20(18)21(22,23)24;1-2-3-4-5/h6-9,12-14H,2-5,10-11,25H2,1H3;5H,2-4H2,1H3 |
| InChIKey | OWQTWHASHGDGQA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine?
The IUPAC name of butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine (CID 145056501) is butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine.
What is the SMILES notation for butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine?
The canonical SMILES for butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine is C=C(N)c1ccc(CCc2ccc(CCCC)cc2)c(C(F)(F)F)c1.CCCCO.
What is the InChIKey of butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine?
The InChIKey is OWQTWHASHGDGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3N.C4H10O/c1-3-4-5-16-6-8-17(9-7-16)10-11-18-12-13-19(15(2)25)14-20(18)21(22,23)24;1-2-3-4-5/h6-9,12-14H,2-5,10-11,25H2,1H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine?
butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine has a molecular weight of 421.55 g/mol, XLogP of 6.54, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine is sourced from PubChem (CID 145056501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).