C28H34F3N5 — CID 145056599
2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide (PubChem CID 145056599) has the molecular formula C28H34F3N5 and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 145056599 |
| Molecular Formula | C28H34F3N5 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1C1=NCC=C(c2ccc(CCc3ccc(CCCC)cc3)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C28H34F3N5/c1-2-3-5-19-7-9-20(10-8-19)11-12-21-13-14-22(18-23(21)28(29,30)31)24-15-16-34-26(35-24)25-6-4-17-36(25)27(32)33/h7-10,13-15,18,25H,2-6,11-12,16-17H2,1H3,(H3,32,33)(H,34,35) |
| InChIKey | PIZYKCVQVRRWSF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|