C38H50BF3N4O3 — CID 145056636
tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate (PubChem CID 145056636) has the molecular formula C38H50BF3N4O3 and a molecular weight of 678.65 g/mol. Its IUPAC name is tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate.
| Compound Name | tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate |
|---|---|
| PubChem CID | 145056636 |
| Molecular Formula | C38H50BF3N4O3 |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 678.39 |
| IUPAC Name | tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate |
| SMILES | C/C=C(\N=C(\C(C)CC)C1CCCN1/C(=B/OC#N)NC(=O)OC(C)(C)C)c1ccc(CCc2ccc(CCCC)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H50BF3N4O3/c1-8-11-13-27-15-17-28(18-16-27)19-20-29-21-22-30(24-31(29)38(40,41)42)32(10-3)44-34(26(4)9-2)33-14-12-23-46(33)35(39-48-25-43)45-36(47)49-37(5,6)7/h10,15-18,21-22,24,26,33H,8-9,11-14,19-20,23H2,1-7H3,(H,45,47)/b32-10-,44-34- |
| InChIKey | JWQBCRPIUYOBTJ-FSRUYHDLSA-N |
| XLogP | 8.87 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|