C17H21FN2O2 — CID 145057494
ethane;2-ethyl-5-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[2,3-d]pyrimidin-4-one (PubChem CID 145057494) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is ethane;2-ethyl-5-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[2,3-d]pyrimidin-4-one.
| Compound Name | ethane;2-ethyl-5-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145057494 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethane;2-ethyl-5-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[2,3-d]pyrimidin-4-one |
| SMILES | C=C/C=C(\C=C/C)n1c(CC)nc2occ(F)c2c1=O.CC |
| InChI | InChI=1S/C15H15FN2O2.C2H6/c1-4-7-10(8-5-2)18-12(6-3)17-14-13(15(18)19)11(16)9-20-14;1-2/h4-5,7-9H,1,6H2,2-3H3;1-2H3/b8-5-,10-7+; |
| InChIKey | VKEBWLIGLXEUQI-ABCYDXHISA-N |
| XLogP | 4.32 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|