About 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine
2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine (PubChem CID 14505759) has the molecular formula C5H3ClN4S
and a molecular weight of 186.63 g/mol. Its IUPAC name is 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 14505759 |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.63 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2nc(Cl)sc12 |
| InChI | InChI=1S/C5H3ClN4S/c6-5-10-4-2(11-5)3(7)8-1-9-4/h1H,(H2,7,8,9) |
| InChIKey | ZYBSHUFTHAOMSD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.63 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine (CID 14505759) is 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine is Nc1ncnc2nc(Cl)sc12.
What is the InChIKey of 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is ZYBSHUFTHAOMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4S/c6-5-10-4-2(11-5)3(7)8-1-9-4/h1H,(H2,7,8,9).
What are the key properties of 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine?
2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 186.63 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-[1,3]thiazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 14505759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).