C13H13NO3 — CID 145057660
5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-oxazole-3-carboxylic acid (PubChem CID 145057660) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 145057660 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-oxazole-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C=C\C)c1cc(C(=O)O)no1 |
| InChI | InChI=1S/C13H13NO3/c1-3-5-6-8-10(7-4-2)12-9-11(13(15)16)14-17-12/h3-9H,2H2,1H3,(H,15,16)/b5-3-,8-6-,10-7+ |
| InChIKey | TXIOFIFRQWVUJX-GSKGFLMHSA-N |
| XLogP | 3.07 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|