C21H25N3O3S — CID 145058173
N-tert-butyl-2-[(E)-2-(2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl)ethenyl]benzenesulfonamide (PubChem CID 145058173) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-tert-butyl-2-[(E)-2-(2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl)ethenyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-[(E)-2-(2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl)ethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 145058173 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-tert-butyl-2-[(E)-2-(2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl)ethenyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1/C=C/c1cccc2c1NCCC(=O)N2 |
| InChI | InChI=1S/C21H25N3O3S/c1-21(2,3)24-28(26,27)18-10-5-4-7-15(18)11-12-16-8-6-9-17-20(16)22-14-13-19(25)23-17/h4-12,22,24H,13-14H2,1-3H3,(H,23,25)/b12-11+ |
| InChIKey | VLHVMZUBRNKLRQ-VAWYXSNFSA-N |
| XLogP | 3.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|