C21H18N4O — CID 145058454
2-[(4S)-4-ethenyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]-1-methylindole-6-carbonitrile (PubChem CID 145058454) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[(4S)-4-ethenyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]-1-methylindole-6-carbonitrile.
| Compound Name | 2-[(4S)-4-ethenyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]-1-methylindole-6-carbonitrile |
|---|---|
| PubChem CID | 145058454 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[(4S)-4-ethenyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]-1-methylindole-6-carbonitrile |
| SMILES | C=C[C@@H]1CC(=O)Nc2cccc(-c3cc4ccc(C#N)cc4n3C)c2N1 |
| InChI | InChI=1S/C21H18N4O/c1-3-15-11-20(26)24-17-6-4-5-16(21(17)23-15)19-10-14-8-7-13(12-22)9-18(14)25(19)2/h3-10,15,23H,1,11H2,2H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | QVLFSZZBNBDPSE-OAHLLOKOSA-N |
| XLogP | 4.03 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|