C14H18N4O4S — CID 145058801
5-amino-3-[1-(3-hydroxyhex-4-yn-2-yloxy)propyl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 145058801) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-amino-3-[1-(3-hydroxyhex-4-yn-2-yloxy)propyl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[1-(3-hydroxyhex-4-yn-2-yloxy)propyl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 145058801 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 5-amino-3-[1-(3-hydroxyhex-4-yn-2-yloxy)propyl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CC#CC(O)C(C)OC(CC)n1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H18N4O4S/c1-4-6-8(19)7(3)22-9(5-2)18-11-10(23-14(18)21)12(20)17-13(15)16-11/h7-9,19H,5H2,1-3H3,(H3,15,16,17,20) |
| InChIKey | TVCQDWKKHJDGHU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|