C27H24F3N3O2 — CID 145059595
4-[2-[2-[[(1E,3Z,8E)-cyclonona-1,3,8-trien-1-yl]methoxy]-4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)phenyl]ethynyl]-3-(trifluoromethyl)phenol (PubChem CID 145059595) has the molecular formula C27H24F3N3O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is 4-[2-[2-[[(1E,3Z,8E)-cyclonona-1,3,8-trien-1-yl]methoxy]-4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)phenyl]ethynyl]-3-(trifluoromethyl)phenol.
| Compound Name | 4-[2-[2-[[(1E,3Z,8E)-cyclonona-1,3,8-trien-1-yl]methoxy]-4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)phenyl]ethynyl]-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 145059595 |
| Molecular Formula | C27H24F3N3O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 4-[2-[2-[[(1E,3Z,8E)-cyclonona-1,3,8-trien-1-yl]methoxy]-4-(2,3-dihydro-1H-1,2,4-triazol-5-yl)phenyl]ethynyl]-3-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C#Cc2ccc(C3=NCNN3)cc2OCC2=C/C=C/CCC\C=C\2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H24F3N3O2/c28-27(29,30)24-16-23(34)14-13-20(24)9-10-21-11-12-22(26-31-18-32-33-26)15-25(21)35-17-19-7-5-3-1-2-4-6-8-19/h3,5-8,11-16,32,34H,1-2,4,17-18H2,(H,31,33)/b5-3+,8-6+,19-7+ |
| InChIKey | FTEKHXLSHSTYJT-IWAIMTEDSA-N |
| XLogP | 5.22 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|