C10H20O4 — CID 145059775
ethene;(2R,4S,5R)-4-(3-hydroxypropyl)-2-methyl-1,3-dioxan-5-ol (PubChem CID 145059775) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is ethene;(2R,4S,5R)-4-(3-hydroxypropyl)-2-methyl-1,3-dioxan-5-ol.
| Compound Name | ethene;(2R,4S,5R)-4-(3-hydroxypropyl)-2-methyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 145059775 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethene;(2R,4S,5R)-4-(3-hydroxypropyl)-2-methyl-1,3-dioxan-5-ol |
| SMILES | C=C.C[C@@H]1OC[C@@H](O)[C@H](CCCO)O1 |
| InChI | InChI=1S/C8H16O4.C2H4/c1-6-11-5-7(10)8(12-6)3-2-4-9;1-2/h6-10H,2-5H2,1H3;1-2H2/t6-,7-,8+;/m1./s1 |
| InChIKey | ZPJGQXDQDKSNIL-LRACWOHVSA-N |
| XLogP | 0.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|