C14H17N — CID 145059986
10-methyl-3,8a,9,10a-tetrahydro-2H-acridine (PubChem CID 145059986) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 10-methyl-3,8a,9,10a-tetrahydro-2H-acridine.
| Compound Name | 10-methyl-3,8a,9,10a-tetrahydro-2H-acridine |
|---|---|
| PubChem CID | 145059986 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 10-methyl-3,8a,9,10a-tetrahydro-2H-acridine |
| SMILES | CN1C2=CCCC=C2CC2C=CC=CC21 |
| InChI | InChI=1S/C14H17N/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2,4,6-9,11,13H,3,5,10H2,1H3 |
| InChIKey | RVFJIWDZWYMFPH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |