About 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite
2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite (PubChem CID 145060150) has the molecular formula C10H15IO2S
and a molecular weight of 326.20 g/mol. Its IUPAC name is 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite.
Molecular Properties
| Compound Name | 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite |
| PubChem CID | 145060150 |
| Molecular Formula | C10H15IO2S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite |
| SMILES | CC1=CCC(COCCOSI)=CC1 |
| InChI | InChI=1S/C10H15IO2S/c1-9-2-4-10(5-3-9)8-12-6-7-13-14-11/h2,5H,3-4,6-8H2,1H3 |
| InChIKey | LIEAFVYKLZXPPG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite?
The IUPAC name of 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite (CID 145060150) is 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite.
What is the SMILES notation for 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite?
The canonical SMILES for 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite is CC1=CCC(COCCOSI)=CC1.
What is the InChIKey of 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite?
The InChIKey is LIEAFVYKLZXPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IO2S/c1-9-2-4-10(5-3-9)8-12-6-7-13-14-11/h2,5H,3-4,6-8H2,1H3.
What are the key properties of 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite?
2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite has a molecular weight of 326.20 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethoxy thiohypoiodite is sourced from PubChem (CID 145060150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).