C28H30N2O7 — CID 145061017
4-(furan-2-yl)-N-[hydroxy-[2-[[3-(2-oxoethyl)-1,2-oxazol-5-yl]methoxy]phenyl]methyl]-N-propan-2-ylbenzamide;methanol (PubChem CID 145061017) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[hydroxy-[2-[[3-(2-oxoethyl)-1,2-oxazol-5-yl]methoxy]phenyl]methyl]-N-propan-2-ylbenzamide;methanol.
| Compound Name | 4-(furan-2-yl)-N-[hydroxy-[2-[[3-(2-oxoethyl)-1,2-oxazol-5-yl]methoxy]phenyl]methyl]-N-propan-2-ylbenzamide;methanol |
|---|---|
| PubChem CID | 145061017 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 4-(furan-2-yl)-N-[hydroxy-[2-[[3-(2-oxoethyl)-1,2-oxazol-5-yl]methoxy]phenyl]methyl]-N-propan-2-ylbenzamide;methanol |
| SMILES | CC(C)N(C(=O)c1ccc(-c2ccco2)cc1)C(O)c1ccccc1OCc1cc(CC=O)no1.CO |
| InChI | InChI=1S/C27H26N2O6.CH4O/c1-18(2)29(26(31)20-11-9-19(10-12-20)24-8-5-15-33-24)27(32)23-6-3-4-7-25(23)34-17-22-16-21(13-14-30)28-35-22;1-2/h3-12,14-16,18,27,32H,13,17H2,1-2H3;2H,1H3 |
| InChIKey | TUWJBGHCQBNJCG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|