About ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol
ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol (PubChem CID 145061110) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol.
Molecular Properties
| Compound Name | ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol |
| PubChem CID | 145061110 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol |
| SMILES | CC.CC.Cc1ocnc1C(C)O |
| InChI | InChI=1S/C6H9NO2.2C2H6/c1-4(8)6-5(2)9-3-7-6;2*1-2/h3-4,8H,1-2H3;2*1-2H3 |
| InChIKey | MCUPGPYGXWYLIO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol?
The IUPAC name of ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol (CID 145061110) is ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol.
What is the SMILES notation for ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol?
The canonical SMILES for ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol is CC.CC.Cc1ocnc1C(C)O.
What is the InChIKey of ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol?
The InChIKey is MCUPGPYGXWYLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.2C2H6/c1-4(8)6-5(2)9-3-7-6;2*1-2/h3-4,8H,1-2H3;2*1-2H3.
What are the key properties of ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol?
ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol has a molecular weight of 187.28 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(5-methyl-1,3-oxazol-4-yl)ethanol is sourced from PubChem (CID 145061110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).