C29H34N2O8 — CID 145061164
2-[5-[[2-[dihydroxy-[methyl(propan-2-yl)amino]methyl]phenoxy]methyl]-1,2-oxazol-3-yl]acetaldehyde;4-(furan-2-yl)benzaldehyde;methanol (PubChem CID 145061164) has the molecular formula C29H34N2O8 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[5-[[2-[dihydroxy-[methyl(propan-2-yl)amino]methyl]phenoxy]methyl]-1,2-oxazol-3-yl]acetaldehyde;4-(furan-2-yl)benzaldehyde;methanol.
| Compound Name | 2-[5-[[2-[dihydroxy-[methyl(propan-2-yl)amino]methyl]phenoxy]methyl]-1,2-oxazol-3-yl]acetaldehyde;4-(furan-2-yl)benzaldehyde;methanol |
|---|---|
| PubChem CID | 145061164 |
| Molecular Formula | C29H34N2O8 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 2-[5-[[2-[dihydroxy-[methyl(propan-2-yl)amino]methyl]phenoxy]methyl]-1,2-oxazol-3-yl]acetaldehyde;4-(furan-2-yl)benzaldehyde;methanol |
| SMILES | CC(C)N(C)C(O)(O)c1ccccc1OCc1cc(CC=O)no1.CO.O=Cc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C17H22N2O5.C11H8O2.CH4O/c1-12(2)19(3)17(21,22)15-6-4-5-7-16(15)23-11-14-10-13(8-9-20)18-24-14;12-8-9-3-5-10(6-4-9)11-2-1-7-13-11;1-2/h4-7,9-10,12,21-22H,8,11H2,1-3H3;1-8H;2H,1H3 |
| InChIKey | UQCCSTKXPZEIFW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|