C19H25F5N2O3 — CID 145061365
7-amino-6-fluoro-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one;cyclopentanecarboxamide (PubChem CID 145061365) has the molecular formula C19H25F5N2O3 and a molecular weight of 424.41 g/mol. Its IUPAC name is 7-amino-6-fluoro-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one;cyclopentanecarboxamide.
| Compound Name | 7-amino-6-fluoro-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one;cyclopentanecarboxamide |
|---|---|
| PubChem CID | 145061365 |
| Molecular Formula | C19H25F5N2O3 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 7-amino-6-fluoro-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one;cyclopentanecarboxamide |
| SMILES | NC(=O)C1CCCC1.NCC(F)CCCC(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H14F5NO2.C6H11NO/c14-7(5-19)2-1-3-8(20)6-21-13-11(17)9(15)4-10(16)12(13)18;7-6(8)5-3-1-2-4-5/h4,7H,1-3,5-6,19H2;5H,1-4H2,(H2,7,8) |
| InChIKey | WFCNXDQBXGJQKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|