About 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane
5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane (PubChem CID 145061506) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane.
Molecular Properties
| Compound Name | 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane |
| PubChem CID | 145061506 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane |
| SMILES | CC.CCNC(=O)c1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C9H15N3O2.C2H6/c1-5-10-7(13)6-11-8(14-12-6)9(2,3)4;1-2/h5H2,1-4H3,(H,10,13);1-2H3 |
| InChIKey | XCBFCCQCPPHUSU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane?
The IUPAC name of 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane (CID 145061506) is 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane.
What is the SMILES notation for 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane?
The canonical SMILES for 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane is CC.CCNC(=O)c1noc(C(C)(C)C)n1.
What is the InChIKey of 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane?
The InChIKey is XCBFCCQCPPHUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.C2H6/c1-5-10-7(13)6-11-8(14-12-6)9(2,3)4;1-2/h5H2,1-4H3,(H,10,13);1-2H3.
What are the key properties of 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane?
5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane has a molecular weight of 227.31 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-ethyl-1,2,4-oxadiazole-3-carboxamide;ethane is sourced from PubChem (CID 145061506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).