C10H14O6S2 — CID 145062010
4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yloxy)butane-1-sulfonic acid (PubChem CID 145062010) has the molecular formula C10H14O6S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yloxy)butane-1-sulfonic acid.
| Compound Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yloxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 145062010 |
| Molecular Formula | C10H14O6S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yloxy)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCOC1COc2cscc2O1 |
| InChI | InChI=1S/C10H14O6S2/c11-18(12,13)4-2-1-3-14-10-5-15-8-6-17-7-9(8)16-10/h6-7,10H,1-5H2,(H,11,12,13) |
| InChIKey | AZGOHKUGFRQFIA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|