C19H23ClN4O2 — CID 145062429
tert-butyl 3-[6-chloro-4-(2-methyl-3H-pyridazin-5-yl)-2-pyridinyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 145062429) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is tert-butyl 3-[6-chloro-4-(2-methyl-3H-pyridazin-5-yl)-2-pyridinyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-[6-chloro-4-(2-methyl-3H-pyridazin-5-yl)-2-pyridinyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 145062429 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | tert-butyl 3-[6-chloro-4-(2-methyl-3H-pyridazin-5-yl)-2-pyridinyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CN1CC=C(c2cc(Cl)nc(C3=CCN(C(=O)OC(C)(C)C)C3)c2)C=N1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-19(2,3)26-18(25)24-8-6-14(12-24)16-9-15(10-17(20)22-16)13-5-7-23(4)21-11-13/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | QYCBLHSEWSJSDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|