C15H23N3 — CID 145062525
2,6-dimethyl-4-(1-propylpyrazol-4-yl)pyridine;ethane (PubChem CID 145062525) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1-propylpyrazol-4-yl)pyridine;ethane.
| Compound Name | 2,6-dimethyl-4-(1-propylpyrazol-4-yl)pyridine;ethane |
|---|---|
| PubChem CID | 145062525 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,6-dimethyl-4-(1-propylpyrazol-4-yl)pyridine;ethane |
| SMILES | CC.CCCn1cc(-c2cc(C)nc(C)c2)cn1 |
| InChI | InChI=1S/C13H17N3.C2H6/c1-4-5-16-9-13(8-14-16)12-6-10(2)15-11(3)7-12;1-2/h6-9H,4-5H2,1-3H3;1-2H3 |
| InChIKey | FRVWQGLITJZNHL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |