C21H35N5O2 — CID 145062989
N-[(2E,4Z)-5-(methylamino)-1-(1-methylpyrrolidin-3-yl)hexa-2,4-dien-3-yl]acetamide;5-propan-2-yl-1H-pyrazole-3-carbaldehyde (PubChem CID 145062989) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[(2E,4Z)-5-(methylamino)-1-(1-methylpyrrolidin-3-yl)hexa-2,4-dien-3-yl]acetamide;5-propan-2-yl-1H-pyrazole-3-carbaldehyde.
| Compound Name | N-[(2E,4Z)-5-(methylamino)-1-(1-methylpyrrolidin-3-yl)hexa-2,4-dien-3-yl]acetamide;5-propan-2-yl-1H-pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 145062989 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | N-[(2E,4Z)-5-(methylamino)-1-(1-methylpyrrolidin-3-yl)hexa-2,4-dien-3-yl]acetamide;5-propan-2-yl-1H-pyrazole-3-carbaldehyde |
| SMILES | CC(C)c1cc(C=O)n[nH]1.CN/C(C)=C\C(=C/CC1CCN(C)C1)NC(C)=O |
| InChI | InChI=1S/C14H25N3O.C7H10N2O/c1-11(15-3)9-14(16-12(2)18)6-5-13-7-8-17(4)10-13;1-5(2)7-3-6(4-10)8-9-7/h6,9,13,15H,5,7-8,10H2,1-4H3,(H,16,18);3-5H,1-2H3,(H,8,9)/b11-9-,14-6+; |
| InChIKey | WFKNLHLJQTYXLX-ALYKBPASSA-N |
| XLogP | 2.82 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|