C19H21N — CID 145064305
6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-4-methyl-1,2-dihydropyridine (PubChem CID 145064305) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-4-methyl-1,2-dihydropyridine.
| Compound Name | 6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-4-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 145064305 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-4-methyl-1,2-dihydropyridine |
| SMILES | C=C/C(=C\C=C/C)c1cccc(C2=CC(C)=CCN2)c1 |
| InChI | InChI=1S/C19H21N/c1-4-6-8-16(5-2)17-9-7-10-18(14-17)19-13-15(3)11-12-20-19/h4-11,13-14,20H,2,12H2,1,3H3/b6-4-,16-8+ |
| InChIKey | DXDGXMHYUMXARB-MZENOTDRSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|