C15H17NOS — CID 145064410
10-methyl-6,8,9,10,11,12a-hexahydro-[1,3]benzothiazolo[3,2-c][1,3]benzoxazine (PubChem CID 145064410) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 10-methyl-6,8,9,10,11,12a-hexahydro-[1,3]benzothiazolo[3,2-c][1,3]benzoxazine.
| Compound Name | 10-methyl-6,8,9,10,11,12a-hexahydro-[1,3]benzothiazolo[3,2-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 145064410 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 10-methyl-6,8,9,10,11,12a-hexahydro-[1,3]benzothiazolo[3,2-c][1,3]benzoxazine |
| SMILES | CC1CCC2=C(C1)SC1c3ccccc3OCN21 |
| InChI | InChI=1S/C15H17NOS/c1-10-6-7-12-14(8-10)18-15-11-4-2-3-5-13(11)17-9-16(12)15/h2-5,10,15H,6-9H2,1H3 |
| InChIKey | JCRURGJNEUXOPK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |