About 1,5-bis(ethenyl)triazole;ethane
1,5-bis(ethenyl)triazole;ethane (PubChem CID 145064562) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1,5-bis(ethenyl)triazole;ethane.
Molecular Properties
| Compound Name | 1,5-bis(ethenyl)triazole;ethane |
| PubChem CID | 145064562 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1,5-bis(ethenyl)triazole;ethane |
| SMILES | C=Cc1cnnn1C=C.CC.CC |
| InChI | InChI=1S/C6H7N3.2C2H6/c1-3-6-5-7-8-9(6)4-2;2*1-2/h3-5H,1-2H2;2*1-2H3 |
| InChIKey | LSWAEBMRVSATLO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-bis(ethenyl)triazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(ethenyl)triazole;ethane?
The IUPAC name of 1,5-bis(ethenyl)triazole;ethane (CID 145064562) is 1,5-bis(ethenyl)triazole;ethane.
What is the SMILES notation for 1,5-bis(ethenyl)triazole;ethane?
The canonical SMILES for 1,5-bis(ethenyl)triazole;ethane is C=Cc1cnnn1C=C.CC.CC.
What is the InChIKey of 1,5-bis(ethenyl)triazole;ethane?
The InChIKey is LSWAEBMRVSATLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3.2C2H6/c1-3-6-5-7-8-9(6)4-2;2*1-2/h3-5H,1-2H2;2*1-2H3.
What are the key properties of 1,5-bis(ethenyl)triazole;ethane?
1,5-bis(ethenyl)triazole;ethane has a molecular weight of 181.28 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(ethenyl)triazole;ethane is sourced from PubChem (CID 145064562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).