About 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine
3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 145065258) has the molecular formula C7H7FN2
and a molecular weight of 138.14 g/mol. Its IUPAC name is 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine |
| PubChem CID | 145065258 |
| Molecular Formula | C7H7FN2 |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC(C)=C(F)\C1=N\[H] |
| InChI | InChI=1S/C7H7FN2/c1-4-2-3-5(9)7(10)6(4)8/h2-3,9-10H,1H3/b9-5+,10-7+ |
| InChIKey | NHSXELVJNJSVNL-FWMCCXIMSA-N |
| XLogP | 1.84 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine?
The IUPAC name of 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine (CID 145065258) is 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine.
What is the SMILES notation for 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine?
The canonical SMILES for 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine is [H]/N=C1\C=CC(C)=C(F)\C1=N\[H].
What is the InChIKey of 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine?
The InChIKey is NHSXELVJNJSVNL-FWMCCXIMSA-N. The full InChI is InChI=1S/C7H7FN2/c1-4-2-3-5(9)7(10)6(4)8/h2-3,9-10H,1H3/b9-5+,10-7+.
What are the key properties of 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine?
3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine has a molecular weight of 138.14 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-methylcyclohexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 145065258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).