About ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate
ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate (PubChem CID 145065770) has the molecular formula C14H27NO4
and a molecular weight of 273.37 g/mol. Its IUPAC name is ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate.
Molecular Properties
| Compound Name | ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate |
| PubChem CID | 145065770 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate |
| SMILES | CC.CC(C)OC(=O)C(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C12H21NO4.C2H6/c1-10(2)17-12(15)11(14)16-9-8-13-6-4-3-5-7-13;1-2/h10H,3-9H2,1-2H3;1-2H3 |
| InChIKey | BGYXFXBOANBLGI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate?
The IUPAC name of ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate (CID 145065770) is ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate.
What is the SMILES notation for ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate?
The canonical SMILES for ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate is CC.CC(C)OC(=O)C(=O)OCCN1CCCCC1.
What is the InChIKey of ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate?
The InChIKey is BGYXFXBOANBLGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4.C2H6/c1-10(2)17-12(15)11(14)16-9-8-13-6-4-3-5-7-13;1-2/h10H,3-9H2,1-2H3;1-2H3.
What are the key properties of ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate?
ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate has a molecular weight of 273.37 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-O-(2-piperidin-1-ylethyl) 2-O-propan-2-yl oxalate is sourced from PubChem (CID 145065770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).