C18H31FS — CID 145066114
5-[4-[(2Z,4Z)-6-fluorohexa-2,4-dien-3-yl]cyclohexyl]-2-methylpentane-1-thiol (PubChem CID 145066114) has the molecular formula C18H31FS and a molecular weight of 298.51 g/mol. Its IUPAC name is 5-[4-[(2Z,4Z)-6-fluorohexa-2,4-dien-3-yl]cyclohexyl]-2-methylpentane-1-thiol.
| Compound Name | 5-[4-[(2Z,4Z)-6-fluorohexa-2,4-dien-3-yl]cyclohexyl]-2-methylpentane-1-thiol |
|---|---|
| PubChem CID | 145066114 |
| Molecular Formula | C18H31FS |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 5-[4-[(2Z,4Z)-6-fluorohexa-2,4-dien-3-yl]cyclohexyl]-2-methylpentane-1-thiol |
| SMILES | C/C=C(\C=C/CF)C1CCC(CCCC(C)CS)CC1 |
| InChI | InChI=1S/C18H31FS/c1-3-17(8-5-13-19)18-11-9-16(10-12-18)7-4-6-15(2)14-20/h3,5,8,15-16,18,20H,4,6-7,9-14H2,1-2H3/b8-5-,17-3+ |
| InChIKey | BMOMKMDCJMRUHG-SMIYXFNTSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|